CAS 100914-20-3

Formula: C15H8Cl2O2

InChI: InChI=1S/C15H8Cl2O2/c16-10-6-11-13(18)8-14(9-4-2-1-3-5-9)19-15(11)12(17)7-10/h1-8H

InChI key: GDMGCDYCMWRPOZ-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=CC(=C3)Cl)Cl

4H-1-Benzopyran-4-one, 6,8-dichloro-2-phenyl-

CAS: 100914-20-3

Formula: C₁₅H₈Cl₂O₂

Peso molecolare: 291.1288

Ref: IN-DA00036V

6,8-Dichloroflavone

CAS: 100914-20-3

6,8-Dichloroflavone is a synthetic flavone derivative, which is characterized by the presence of chloride substitutions on its flavone structure. This compound acts as a selective benzodiazepine receptor partial agonist, specifically interacting with the GABAA receptor complex. Its mode of action involves modulating the inhibitory neurotransmitter gamma-aminobutyric acid (GABA), which enhances GABAergic transmission without fully activating the receptor to the extent of typical benzodiazepines.

Formula: C₁₅H₈Cl₂O₂

Purezza: Min. 95%

Peso molecolare: 291.1 g/mol

Ref: 3D-AEA91420