CAS 100949-37-9

Formula: C8H4BrNO2S

InChI: InChI=1S/C8H4BrNO2S/c9-8-7(10(11)12)5-3-1-2-4-6(5)13-8/h1-4H

InChI key: CJBFUXJMUCCEEV-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C(=C(S2)Br)[N+](=O)[O-]

2-Bromo-3-nitro-1-benzothiophene

CAS: 100949-37-9

2-Bromo-3-nitro-1-benzoatrophen is a nucleophilic amine. It is an organic compound that has the chemical formula C6H5BrNO2. The molecule contains a benzene ring with two nitro groups attached at positions 2 and 3. It is an isomer of 3-nitrobenzothiazole, which has a thiophene ring instead of benzene. Benzothiophene can be synthesized by a nucleophilic substitution reaction between 2-bromobenzaldehyde and nitrous acid. 2-Bromo-3-nitrobenzotrifluoride can also be produced by reacting bromine with nitrous acid in the presence of benzoic acid or benzenesulfonic acid as catalysts. Spectroscopic techniques may be used to identify this compound by its ultraviolet, visible, and infrared absorption spectra.

Formula: C₈H₄BrNO₂S

Purezza: Min. 95%

Peso molecolare: 258.09 g/mol

Ref: 3D-AEA94937