CAS 1016260-22-2

Formula: C30H44O4

InChI: InChI=1S/C30H44O4/c1-19(2)22-11-12-25-24(28(22,5)16-15-26(31)32)14-18-29(6)23(13-17-30(25,29)7)20(3)9-8-10-21(4)27(33)34/h10,14,22,25H,1,8-9,11-13,15-18H2,2-7H3,(H,31,32)(H,33,34)/b21-10-,23-20-/t22-,25+,28-,29+,30-/m0/s1

InChI key: QOIBKZDJHBYYMX-AVNVPESYSA-N

SMILES: CC(=C)[C@@H]1CC[C@@H]2C(=CC[C@]\3([C@]2(CC/C3=C(\C)/CC/C=C(/C)\C(=O)O)C)C)[C@@]1(C)CCC(=O)O

Kadsuracoccinic acid A

CAS: 1016260-22-2

Kadsuracoccinic acid A

Peso molecolare: 468.32

Ref: 10-F559915

Kadsuracoccinic acid A

CAS: 1016260-22-2

Kadsuracoccinic acid A shows anticancer effects by halting cell division in M phase.

Formula: C₃₀H₄₄O₄

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 468.67

Ref: TM-TN4364

Kadsuracoccinic acid A

CAS: 1016260-22-2

Kadsuracoccinic acid A is a triterpenoid natural product, which is derived from the Kadsura genus of plants, specifically extracted from the Schisandraceae family. It exhibits promising pharmacological activities, notable for its potential anti-cancer properties. The mode of action involves interference with cellular pathways that regulate cell proliferation and induction of apoptosis, thereby halting the growth and survival of cancer cells.

Formula: C₃₀H₄₄O₄

Purezza: Min. 95%

Peso molecolare: 468.7 g/mol

Ref: 3D-RQB26022