CAS 1041631-93-9

Formula: C36H56O8

InChI: InChI=1S/C36H56O8/c1-20(2)9-8-10-21(3)22-13-14-35(7)31-25(43-32-30(42)29(41)28(40)26(18-37)44-32)17-24-23(11-12-27(39)33(24,4)5)36(31,19-38)16-15-34(22,35)6/h8-9,17,19,21-23,25-32,37,39-42H,1,10-16,18H2,2-7H3/b9-8+/t21-,22-,23-,25+,26-,27+,28-,29+,30-,31+,32-,34-,35+,36-/m1/s1

InChI key: OMBHCPPEZFBPJG-ZBAJYRRDSA-N

SMILES: C[C@H](C/C=C/C(=C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C=O)C)C

Kuguaglycoside C

CAS: 1041631-93-9

Kuguaglycoside C induces caspase-independent cell death, and is involved, at least in part, in the mechanism underlying cell necroptosis.

Formula: C₃₆H₅₆O₈

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 616.83

Ref: TM-TN1837

Kuguaglycoside C

CAS: 1041631-93-9

Kuguaglycoside C is a naturally occurring glycoside, which is sourced from the plant Momordica charantia, commonly known as bitter melon. This compound is a part of a group of cucurbitane-type triterpenoid glycosides, extracted primarily from the fruit and other parts of the plant. The mode of action of Kuguaglycoside C involves interactions with cellular receptors that influence various biochemical pathways. It has been studied for its potential in modulating glucose metabolism and exhibiting anti-diabetic properties, though detailed mechanisms at the molecular level are still under investigation.

Formula: C₃₆H₅₆O₈

Purezza: Min. 95%

Peso molecolare: 616.8 g/mol

Ref: 3D-RRB63193