CAS 1172118-03-4

Formula: C32H26N8O2S

InChI: InChI=1S/C32H26N8O2S/c1-17-7-4-5-10-24(17)40-22(13-20-9-6-8-18(2)26(20)31(40)42)15-39-30-27(29(33)34-16-35-30)28(38-39)21-11-12-23-25(14-21)43-32(37-23)36-19(3)41/h4-14,16H,15H2,1-3H3,(H2,33,34,35)(H,36,37,41)

InChI key: UHZBJJRBPXOONG-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC=C1)C=C(N(C2=O)C3=CC=CC=C3C)CN4C5=NC=NC(=C5C(=N4)C6=CC7=C(C=C6)N=C(S7)NC(=O)C)N

PI3K-gamma inhibitor 1

CAS: 1172118-03-4

PI3K-gamma inhibitor 1 is a small molecule inhibitor, which is selectively synthesized for targeting the PI3K-gamma isoform. This inhibitor is derived through precise medicinal chemistry, involving the synthesis of compounds that specifically interact with the catalytic domain of the phosphoinositide 3-kinase gamma (PI3K-γ) enzyme. Its mode of action involves the selective inhibition of the PI3K-γ pathway, a critical signaling route responsible for modulating immune cell functions and inflammatory responses.

Formula: C₃₂H₂₆N₈O₂S

Purezza: Min. 95%

Peso molecolare: 586.67 g/mol

Ref: 3D-XWB11803

PI3Kγ inhibitor 1

CAS: 1172118-03-4

PI3Kγ inhibitor 1 is a inhibitor of PI3Kδ and PI3Kγ.

Formula: C₃₂H₂₆N₈O₂S

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 586.67

Ref: TM-T12464

PI3Kγ inhibitor 1

CAS: 1172118-03-4

Formula: C₃₂H₂₆N₈O₂S

Peso molecolare: 586.6662

Ref: IN-DA000DY3