CAS 1175543-06-2

Formula: C21H26O6

InChI: InChI=1S/C21H26O6/c1-19(2)9-7-10-20(3)17(19)15(27-16(23)8-5-4-6-11-22)12-14-13-26-18(24)21(14,20)25/h4-6,8,11-12,15,17,25H,7,9-10,13H2,1-3H3/b6-4+,8-5+/t15-,17+,20+,21+/m1/s1

InChI key: NTEIYTQTTHYBTI-BEFOBABASA-N

SMILES: C[C@]12CCCC([C@@H]1[C@@H](C=C3[C@@]2(C(=O)OC3)O)OC(=O)/C=C/C=C/C=O)(C)C

Ustusolate E

CAS: 1175543-06-2

Ustusolate E exhibits moderate cytotoxicity against A549 and HL-60 cells with the IC50 value of 9.0 microM.

Formula: C₂₁H₂₆O₆

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 374.433

Ref: TM-TN5211

Ustusolate E

CAS: 1175543-06-2

Formula: C₂₁H₂₆O₆

Purezza: 95%~99%

Peso molecolare: 374.433

Ref: BP-BP5226

Ustusolate E

CAS: 1175543-06-2

Formula: C₂₁H₂₆O₆

Purezza: 93.0%

Peso molecolare: 374.4275

Ref: IN-DA01V2TY

Ustusolate E

CAS: 1175543-06-2

Ustusolate E is a biopesticide, which is derived from naturally occurring fungal metabolites. This compound emerges from the secondary metabolites of a specific group of entomopathogenic fungi, known for their ability to target and incapacitate insect pests. The mode of action of Ustusolate E involves interrupting the normal developmental processes during the larval stages of insects, ultimately leading to their death. This disruption is primarily attributed to the inhibition of key growth hormones and the malfunctioning of regulatory pathways essential for insect maturation.

Formula: C₂₁H₂₆O₆

Purezza: Min. 95%

Peso molecolare: 374.4 g/mol

Ref: 3D-AXB54306