
CAS: 1219804-82-6
Descrizione:The chemical substance with the CAS number 1219804-82-6 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular structure, solubility, boiling and melting points, and reactivity. These characteristics are influenced by the functional groups present in the molecule and its overall molecular geometry. For a comprehensive understanding, one would typically refer to specialized chemical databases or scientific literature that provide insights into its physical and chemical properties, safety data, and potential applications. If you are looking for specific characteristics such as toxicity, environmental impact, or industrial uses, consulting a material safety data sheet (MSDS) or peer-reviewed articles would be advisable.
Formula:C17H13D5F3NO·C2H2O4
InChI:InChI=1S/C17H18F3NO.C2H2O4/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20;3-1(4)2(5)6/h2-10,16,21H,11-12H2,1H3;(H,3,4)(H,5,6)/i2D,3D,4D,5D,6D;
InChI key:InChIKey=CKOSCBUBUNGPOY-CERKJNTMSA-N
SMILES:O=C(O)C(=O)O.FC(F)(F)C1=CC=C(OC(C=2C=CC=CC2)CCNC)C=C1
Marchio | Dati del prodotto | Purezza | Fascia di prezzo | Consegna prevista |
---|---|---|---|---|
![]() | (±)-Fluoxetine-d5 Oxalate(phenyl-d5) REF: 3U-D5740CAS: 1219804-82-6 | 99 atom % D | 262,00 €~433,00 € | Lun 31 Mar 25 |
![]() | (±)-Fluoxetine-d5 Oxalate (phenyl-d5) REF: TR-F211186CAS: 1219804-82-6 | - - - | 316,00 €~494,00 € | Mer 07 Mag 25 |

(±)-Fluoxetine-d5 Oxalate(phenyl-d5)
Ref: 3U-D5740
5mg | 262,00 € | ||
10mg | 433,00 € |

(±)-Fluoxetine-d5 Oxalate (phenyl-d5)
Prodotto ControllatoRef: TR-F211186
5mg | 316,00 € | ||
10mg | 494,00 € |