Prodotto aggiunto correttamente al carrello.

Nessuna immagine

CAS: 1219804-82-6

Descrizione:The chemical substance with the CAS number 1219804-82-6 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular structure, solubility, boiling and melting points, and reactivity. These characteristics are influenced by the functional groups present in the molecule and its overall molecular geometry. For a comprehensive understanding, one would typically refer to specialized chemical databases or scientific literature that provide insights into its physical and chemical properties, safety data, and potential applications. If you are looking for specific characteristics such as toxicity, environmental impact, or industrial uses, consulting a material safety data sheet (MSDS) or peer-reviewed articles would be advisable.

Formula:C17H13D5F3NO·C2H2O4

InChI:InChI=1S/C17H18F3NO.C2H2O4/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20;3-1(4)2(5)6/h2-10,16,21H,11-12H2,1H3;(H,3,4)(H,5,6)/i2D,3D,4D,5D,6D;

InChI key:InChIKey=CKOSCBUBUNGPOY-CERKJNTMSA-N

SMILES:O=C(O)C(=O)O.FC(F)(F)C1=CC=C(OC(C=2C=CC=CC2)CCNC)C=C1

Ordinare per


Vedere altre categorie

Questa ricerca non contiene alcuna categoria.

2 prodottitrovati.

discount label

(±)-Fluoxetine-d5 Oxalate(phenyl-d5)

CAS:1219804-82-6

Ref: 3U-D5740

5mg262,00 €
10mg433,00 €
Consegna stimata in Stati Uniti, il Lunedì 31 Marzo 2025
discount label

(±)-Fluoxetine-d5 Oxalate (phenyl-d5)

Prodotto Controllato
CAS:1219804-82-6

Ref: TR-F211186

5mg316,00 €
10mg494,00 €
Consegna stimata in Stati Uniti, il Mercoledì 07 Maggio 2025
Benvenuto su CymitQuimica!Utilizziamo i cookie per migliorare la tua visita. Non includiamo pubblicità.

Consulta la nostra Politica sui Cookie per maggiori dettagli o regola le tue preferenze in "Configura".