CAS 123410-65-1

Formula: C17H20O9

InChI: InChI=1S/C17H20O9/c1-25-16(23)17(24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22,24H,7-8H2,1H3/b5-3+/t12-,13-,15+,17-/m1/s1

InChI key: MZNIJRAPCCELQX-NYCIAPANSA-N

SMILES: COC(=O)[C@]1(C[C@H]([C@@H]([C@@H](C1)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O)O

Neochlorogenic acid methyl ester

CAS: 123410-65-1

Purezza: 98%

Ref: IN-DA01V2RJ

Neochlorogenic acid methyl ester

CAS: 123410-65-1

Neochlorogenic acid methyl ester

Formula: C₁₇H₂₀O₉

Purezza: ≥98%

Peso molecolare: 368.34

Ref: 54-BUP07523

Neochlorogenic acid methyl ester

CAS: 123410-65-1

Neochlorogenic acid methyl ester is from Artemisia and Aronia fruits; it has mild anti-HBV, antioxidant, and quinone reductase activity (CD 6.7 μM).

Formula: C₁₇H₂₀O₉

Purezza: 99.9%

Colore e forma: Solid

Peso molecolare: 368.34

Ref: TM-TN5845

Neochlorogenic acid methyl ester

CAS: 123410-65-1

Formula: C₁₇H₂₀O₉

Purezza: 95%~99%

Peso molecolare: 368.338

Ref: BP-BP2297

Neochlorogenic acid methyl ester

CAS: 123410-65-1

Neochlorogenic acid methyl ester is a methylated ester of neochlorogenic acid, which is a type of polyphenolic compound. It is primarily derived from plant sources, particularly fruits and leaves that are rich in chlorogenic acids. This compound is of significant interest in the scientific community due to its potential antioxidant properties. It acts by donating hydrogen atoms to free radicals, neutralizing them and preventing oxidative stress at the cellular level.

Formula: C₁₇H₂₀O₉

Purezza: Min. 95%

Peso molecolare: 368.3 g/mol

Ref: 3D-YEA41065