CAS: 1234692-67-1

Descrizione:The chemical substance with the CAS number 1234692-67-1 is known as a specific compound, but without a name provided, I cannot give detailed characteristics. Generally, compounds identified by CAS numbers can be characterized by their molecular structure, physical properties (such as boiling point, melting point, and solubility), and chemical behavior (including reactivity and stability). Additionally, they may have applications in various fields such as pharmaceuticals, agriculture, or materials science. To obtain precise information about this compound, including its name, safety data, and specific applications, it is advisable to consult a chemical database or literature that provides comprehensive details on the substance. If you have a specific name or context for this compound, I can provide more tailored information.

Formula:C₁₄H₁₉NO₄·C₆H₁₃N

InChI:InChI=1S/C14H19NO4.C6H13N/c1-14(2,3)11(12(16)17)15-13(18)19-9-10-7-5-4-6-8-10;7-6-4-2-1-3-5-6/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17);6H,1-5,7H2/t11-;/m0./s1

InChI key:InChIKey=RJZAPWBTFPVKPZ-MERQFXBCSA-N

SMILES:O=C(OCC=1C=CC=CC1)NC(C(=O)O)C(C)(C)C.NC1CCCCC1