CAS 1242441-26-4

Formula: C21H21ClN4OS

InChI: InChI=1S/C21H21ClN4OS/c1-25(2)20(27)17-10-16(17)13-4-6-14(7-5-13)19-21(26(3)12-24-19)28-18-9-8-15(22)11-23-18/h4-9,11-12,16-17H,10H2,1-3H3/t16-,17+/m1/s1

InChI key: WRBFPGYDKJBYBI-SJORKVTESA-N

SMILES: CN1C=NC(=C1SC2=NC=C(C=C2)Cl)C3=CC=C(C=C3)[C@H]4C[C@@H]4C(=O)N(C)C

MK-3168 (12C)

CAS: 1242441-26-4

MK-3168 (12C) functions as a FAAH inhibitor, exhibiting IC50 values of 1.0 nM, 5.5 nM, and 1.7 nM for human, rhesus, and rat respectively. It demonstrates effective brain uptake and FAAH-specific signaling. Additionally, 11 C MK-3168 is applicable as a FAAH PET tracer.

Formula: C₂₁H₂₁ClN₄OS

Colore e forma: Solid

Peso molecolare: 412.94

Ref: TM-T200270