CAS 14004-35-4

Formula: C21H20O6

InChI: InChI=1S/C21H20O6/c1-11-19(25-5)12(2)21-18(20(11)26-13(3)22)16(23)10-17(27-21)14-6-8-15(24-4)9-7-14/h6-10H,1-5H3

InChI key: XCJBAXUKWUWAJL-UHFFFAOYSA-N

SMILES: CC1=C2C(=C(C(=C1OC)C)OC(=O)C)C(=O)C=C(O2)C3=CC=C(C=C3)OC

Eucalyptin acetate

CAS: 14004-35-4

Eucalyptin acetate is a useful organic compound for research related to life sciences and the catalog number is T125926.

Formula: C₂₁H₂₀O₆

Colore e forma: Solid

Peso molecolare: 368.38

Ref: TM-T125926

Eucalyptin acetate

CAS: 14004-35-4

Eucalyptin acetate is an ester compound that is primarily utilized in the fragrance industry. It is derived from eucalyptus plants, specifically from their essential oils, which are well-known for their aromatic qualities. The mode of action of eucalyptin acetate involves its interaction with olfactory receptors, stimulating a fresh, invigorating scent profile that is widely appreciated in perfumery and consumer products. Beyond its aromatic applications, eucalyptin acetate is also being explored for its potential therapeutic properties, given the bioactive nature of eucalyptus-derived compounds. Additionally, it may exhibit antimicrobial effects, contributing to its utility in certain medical or hygiene products. Further research into its biochemical interactions and efficacy in various applications remains ongoing, presenting a potential avenue for scientific investigation and innovation in both commercial and medical fields.

Formula: C₂₁H₂₀O₆

Purezza: Min. 95%

Peso molecolare: 368.4 g/mol

Ref: 3D-PAA00435