CAS 1443421-67-7

Formula: C14H18N6O

InChI: InChI=1S/C14H18N6O/c15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21/h1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19)/t8-,10-/m0/s1

InChI key: MCGSCOLBFJQGHM-WPRPVWTQSA-N

SMILES: C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@H](C=C4)CO

Abacavir EP Impurity D

CAS: 1443421-67-7

Formula: C₁₄H₁₈N₆O

Peso molecolare: 322.79

Ref: 4Z-A-288

(R,R)-Abacavir

CAS: 1443421-67-7

(R,R)-Abacavir is the (R,R)-enantiomer of Abacavir. Abacavir is an orally active, competitive nucleoside reverse transcriptase inhibitor. It inhibits HIV replication and demonstrates anticancer activity in prostate cancer cell lines. Additionally, Abacavir can cross the blood-brain barrier and suppress telomerase activity.

Formula: C₁₄H₁₈N₆O

Peso molecolare: 286.34

Ref: TM-TYD-05062