CAS 1446648-15-2

Formula: C22H18N2O2

InChI: InChI=1S/C22H18N2O2/c25-24(26)15-19(16-9-3-1-4-10-16)21-18-13-7-8-14-20(18)23-22(21)17-11-5-2-6-12-17/h1-14,19,23H,15H2/t19-/m1/s1

InChI key: OHZDCJJHWPHZJD-LJQANCHMSA-N

SMILES: C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)[C@H](C[N+](=O)[O-])C4=CC=CC=C4

GAT228

CAS: 1446648-15-2

GAT228 is a herbicide that functions as an enzyme inhibitor, originating from synthetic chemical formulations developed for agricultural use. The mode of action involves inhibiting specific enzymes that are crucial for the growth and survival of certain plant species, thereby disrupting their normal physiological processes. This interruption prevents the synthesis of essential amino acids, ultimately leading to the death of the targeted weeds.

Formula: C₂₂H₁₈N₂O₂

Purezza: Min. 95%

Peso molecolare: 342.4 g/mol

Ref: 3D-WHC64815

GAT228

CAS: 1446648-15-2

GAT228, an allosteric ligand for the cannabinoid receptor 1 (CB1), functions as the enantiomer of GAT211 [1].

Formula: C₂₂H₁₈N₂O₂

Colore e forma: Solid

Peso molecolare: 342.39

Ref: TM-T61105