CAS 149691-31-6

Formula: C23H30O5

InChI: InChI=1S/C23H30O5/c1-12-5-6-17-21(2,3)18(25)7-8-22(17,4)23(12)10-14-16(24)9-13-15(19(14)28-23)11-27-20(13)26/h9,12,17-18,24-25H,5-8,10-11H2,1-4H3/t12-,17+,18-,22+,23-/m1/s1

InChI key: HKNSYAPUOMHZDE-RCJATNNHSA-N

SMILES: C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)COC5=O)O)(CC[C@H](C2(C)C)O)C

Stachybotrolide

CAS: 149691-31-6

Stachybotrolide is a natural product from Stachybotrys alternans.

Formula: C₂₃H₃₀O₅

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 386.48

Ref: TM-TN5058

Stachybotrolide

CAS: 149691-31-6

Formula: C₂₃H₃₀O₅

Purezza: 95%~99%

Peso molecolare: 386.488

Ref: BP-SBP03736

Stachybotrolide

CAS: 149691-31-6

Stachybotrolide is a fungal secondary metabolite, which is a complex organic compound produced by certain fungi. It is sourced primarily from the genus Stachybotrys, known for producing a variety of bioactive metabolites. The mode of action of stachybotrolide involves binding to specific molecular targets within biological systems, often influencing cell signaling pathways. This can lead to various biochemical effects, making it a compound of interest in bioactive compound research.

Formula: C₂₃H₃₀O₅

Purezza: Min. 95%

Peso molecolare: 386.5 g/mol

Ref: 3D-ZFA69131