CAS 1902173-19-6

Formula: C29H40O3

InChI: InChI=1S/C29H40O3/c1-26(2)14-8-15-27(3)22(26)18-24(32-25(30)12-11-20-9-6-5-7-10-20)29-16-13-21(17-23(27)29)28(4,31)19-29/h5-7,9-12,21-24,31H,8,13-19H2,1-4H3/b12-11+/t21-,22+,23-,24+,27+,28-,29+/m0/s1

InChI key: MEPUSQCBPSPYRT-LNNCMZRWSA-N

SMILES: C[C@@]12CCCC([C@H]1C[C@H]([C@]34[C@H]2C[C@H](CC3)[C@@](C4)(C)O)OC(=O)/C=C/C5=CC=CC=C5)(C)C

Spiratisanin B

CAS: 1902173-19-6

Formula: C₂₉H₄₀O₃

Purezza: 97.5%

Peso molecolare: 436.6261

Ref: IN-DA01V3P4

Spiratisanin B

CAS: 1902173-19-6

Spiratisanin B is a natural sesquiterpene lactone, which is extracted from the plant species Spiraea japonica. This compound is part of the diverse class of secondary metabolites that plants produce, and its molecular structure is characterized by the presence of a lactone ring, contributing to its biological activity. The mode of action of Spiratisanin B involves its ability to interact with specific cellular targets, potentially modulating enzymatic pathways and affecting cellular signaling processes.

Formula: C₂₉H₄₀O₃

Purezza: Min. 95%

Peso molecolare: 436.6 g/mol

Ref: 3D-CBD17319