CAS 21602-56-2

1-(2-fenilpropan-2-il)piperidina cloridrato (1:1)

Formula: C₁₄H₂₂ClN

InChI: InChI=1/C14H21N.ClH/c1-14(2,13-9-5-3-6-10-13)15-11-7-4-8-12-15;/h3,5-6,9-10H,4,7-8,11-12H2,1-2H3;1H

SMILES: CC(C)(c1ccccc1)N1CCCCC1.Cl

1-(2-Phenylpropan-2-yl)piperidine hydrochloride

CAS: 21602-56-2

1-(2-Phenylpropan-2-yl)piperidine hydrochloride is a chemical compound categorized as a piperidine derivative. Piperidines are a class of organic compounds based on a six-membered ring containing five carbon atoms and one nitrogen atom. This particular compound is synthesized through a series of chemical reactions involving its precursor piperidine, and then combined with hydrochloric acid to form its hydrochloride salt, which increases its solubility and stability.

Formula: C₁₄H₂₂ClN

Purezza: Min. 95%

Peso molecolare: 239.78 g/mol

Ref: 3D-WAA60256