CAS 299953-00-7

Formula: C10H8N2O2S

InChI: InChI=1S/C10H8N2O2S/c11-10-12-9(14)8(15-10)5-6-1-3-7(13)4-2-6/h1-5,13H,(H2,11,12,14)/b8-5-

InChI key: YBHQCJILTOVLHD-YVMONPNESA-N

SMILES: C1=CC(=CC=C1/C=C\2/C(=O)N=C(S2)N)O

5-(4-Hydroxybenzylidene)-2-iminothiazolidin-4-one

CAS: 299953-00-7

5-(4-Hydroxybenzylidene)-2-iminothiazolidin-4-one

Formula: C₁₀H₈N₂O₂S

Purezza: 99%

Peso molecolare: 220.25

Ref: 54-OR1065330

Mirin

CAS: 299953-00-7

Formula: C₁₀H₈N₂O₂S

Purezza: 99%

Peso molecolare: 220.2477

Ref: IN-DA007JVR

Mirin

CAS: 299953-00-7

5-(4-Hydroxybenzylidene)-2-iminothiazolidin-4-one

Formula: C₁₀H₈N₂O₂S

Purezza: 99%

Peso molecolare: 220.24

Ref: IN-DG229017

Mirin

CAS: 299953-00-7

Mirin is a Mre11-Rad50-Nbs1 (MRN) complex inhibitor and also inhibits Mre11-associated exonuclease activity.Mirin induces cell cycle arrest in G1 phase.

Formula: C₁₀H₈N₂O₂S

Purezza: 99.24%

Colore e forma: Solid

Peso molecolare: 220.248

Ref: TM-T60273

MRN-ATM Pathway Inhibitor, Mirin

CAS: 299953-00-7

MRN-ATM Pathway Inhibitor, Mirin, is a small molecule inhibitor, which is chemically synthesized to specifically target the MRN complex and ATM kinase pathway. It functions by disrupting the activation of ATM (Ataxia-Telangiectasia Mutated) kinase, a crucial player in the DNA damage response and repair mechanism, which is activated by the MRN complex in response to DNA double-strand breaks. Mirin's mode of action involves inhibiting the interaction between the MRN complex and ATM, thus preventing the phosphorylation of ATM substrates involved in DNA repair.

Formula: C₁₀H₈N₂O₂S

Purezza: Min. 95%

Peso molecolare: 220.25 g/mol

Ref: 3D-ZLA95300