CAS 322391-26-4

Formula: C7H15Cl2N

InChI: InChI=1S/C7H14ClN.ClH/c1-7(6-8)9-4-2-3-5-9;/h7H,2-6H2,1H3;1H

InChI key: RBCAJUWPIJXRML-UHFFFAOYSA-N

SMILES: CC(CCl)N1CCCC1.Cl

1-(2-Chloro-1-methylethyl)pyrrolidine hydrochloride

CAS: 322391-26-4

1-(2-Chloro-1-methylethyl)pyrrolidine hydrochloride is a versatile building block that can be used in the synthesis of fine chemicals, complex compounds, research chemicals, reagents and specialty chemicals. This compound is also useful as a building block for the synthesis of pharmaceuticals and chemical products. 1-(2-Chloro-1-methylethyl)pyrrolidine hydrochloride is a high quality chemical that can be used as a reaction component or scaffold for the synthesis of new chemical entities.

Formula: C₇H₁₅Cl₂N

Purezza: Min. 95%

Colore e forma: Powder

Peso molecolare: 184.1 g/mol

Ref: 3D-FC116878

1-(2-chloro-1-methylethyl)pyrrolidine hydrochloride

CAS: 322391-26-4

Formula: C₇H₁₅Cl₂N

Purezza: 95%

Peso molecolare: 184.1

Ref: 10-F360120