CAS 322474-09-9

Formula: C9H11NO4

InChI: InChI=1S/C9H11NO4/c1-14-9-3-2-7(6-8(9)11)4-5-10(12)13/h2-3,6,11H,4-5H2,1H3

InChI key: ITIMUCQQHDXMIW-UHFFFAOYSA-N

SMILES: COC1=C(C=C(C=C1)CC[N+](=O)[O-])O

1-(3-Hydroxy-4-methoxyphenyl)-2-nitroethane

CAS: 322474-09-9

1-(3-Hydroxy-4-methoxyphenyl)-2-nitroethane is a chemical intermediate that can be used in the synthesis of other compounds. It is a fine chemical with many potential uses, as well as being a versatile building block for organic synthesis. As an example, 1-(3-Hydroxy-4-methoxyphenyl)-2-nitroethane can be used to synthesize the drug erythromycin. This chemical has been shown to have antihistamine and antiinflammatory properties.

Formula: C₉H₁₁NO₄

Purezza: Min. 95%

Peso molecolare: 197.19 g/mol

Ref: 3D-FH67363