CAS 324780-02-1

Formula: C18H20N4O4

InChI: InChI=1S/C18H20N4O4/c1-3-19(4-2)9-10-20-17-7-5-13(21(23)24)11-15(17)16-12-14(22(25)26)6-8-18(16)20/h5-8,11-12H,3-4,9-10H2,1-2H3

InChI key: GRXHSPDYFQLEAA-UHFFFAOYSA-N

SMILES: CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C3=C1C=CC(=C3)[N+](=O)[O-]

Cblc000 trifluoroacetate

CAS: 324780-02-1

Cblc000 trifluoroacetate is a synthetic peptide, which is derived from chemical synthesis with trifluoroacetic acid as a counterion. It functions by selectively interacting with target proteins, thereby modulating their activity. This interaction is influenced by its specific amino acid sequence, allowing it to bind with high specificity and affinity to particular protein domains, often disrupting or enhancing their biological function.

Formula: C₁₈H₂₀N₄O₄

Purezza: Min. 95%

Peso molecolare: 356.4 g/mol

Ref: 3D-ZMA78002