CAS 325686-49-5

Formula: C19H32O8

InChI: InChI=1S/C19H32O8/c1-10(21)4-5-13-18(2)6-11(7-19(13,3)25-9-18)26-17-16(24)15(23)14(22)12(8-20)27-17/h11-17,20,22-24H,4-9H2,1-3H3/t11-,12+,13+,14+,15-,16+,17+,18+,19+/m0/s1

InChI key: FUGMJWOONJABQQ-QUQGRMMRSA-N

SMILES: CC(=O)CC[C@@H]1[C@@]2(C[C@@H](C[C@]1(OC2)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C

Ascleposide E

CAS: 325686-49-5

Ascleposide E is a natural product of Aucklandia, Asteraceae.

Formula: C₁₉H₃₂O₈

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 388.4526

Ref: TM-TN3459

Ascleposide E

CAS: 325686-49-5

Formula: C₁₉H₃₂O₈

Purezza: 95%~99%

Colore e forma: Powder

Peso molecolare: 388.457

Ref: BP-SBP00010

Ascleposide E

CAS: 325686-49-5

Ascleposide E is a glycoside compound, which is a naturally derived product primarily isolated from plants in the Asclepiadaceae family. Known for its intricate chemical structure, Ascleposide E is extracted from traditional medicinal flora, highlighting its importance in ethnopharmacology. Its mode of action involves interacting with cellular pathways that can have significant biological effects, potentially influencing enzyme activity and receptor modulation.

Formula: C₁₉H₃₂O₈

Purezza: Min. 95%

Peso molecolare: 388.5 g/mol

Ref: 3D-ANA68649