CAS 3829-23-0

Formula: C6H3ClFNO4S

InChI: InChI=1S/C6H3ClFNO4S/c7-5-2-1-4(9(10)11)3-6(5)14(8,12)13/h1-3H

InChI key: TYNYYQQHOOZVCQ-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)F)Cl

GSTP1-1 inhibitor 1

CAS: 3829-23-0

GSTP1-1 Inhibitor 1 (compound 6b) is an irreversible, long-acting inhibitor of glutathione S-transferase with a specific focus on GSTP 1-1, exhibiting an IC 50 of 21 μM. As GSTP 1-1 plays a crucial role in tumor suppression, this compound shows promising potential for anticancer activity [1].

Formula: C₆H₃ClFNO₄S

Colore e forma: Solid

Peso molecolare: 239.61

Ref: TM-T86530