CAS 38302-15-7

Formula: C18H18O5

InChI: InChI=1S/C18H18O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-9,15H,10H2,1-3H3

InChI key: MQFSCAHSIUPLSB-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Purezza: 99%

Colore e forma: Solid

Peso molecolare: 314.3325

Ref: IN-DA00CHVF

Naringenin trimethyl ether

CAS: 38302-15-7

Naringenin trimethyl ether

Formula: C₁₈H₁₈O₅

Purezza: ≥98%

Peso molecolare: 314.33

Ref: 54-BUP09965

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Peso molecolare: 314.34

Ref: 7W-GY1544

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Purezza: 95%~99%

Peso molecolare: 314.337

Ref: BP-SBP00403

Diosmin Impurity 6

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Peso molecolare: 314.34

Ref: 4Z-D-4516

Naringenin trimethyl ether

CAS: 38302-15-7

Naringenin trimethyl ether is a flavonoid compound, which is typically derived from citrus fruits and other plant sources. This compound is part of the larger class of polyphenolic compounds known as flavonoids, which are prominent for their presence in various plant species, contributing to a variety of physiological activities.

Formula: C₁₈H₁₈O₅

Purezza: Min. 95%

Colore e forma: Powder

Peso molecolare: 314.33 g/mol

Ref: 3D-XN161726

Naringenin trimethyl ether

CAS: 38302-15-7

Ref: BE-RMCD164008

Naringenin trimethyl ether

CAS: 38302-15-7

(S)-5,7-Dimethoxy-2-(4-methoxyphenyl)chroman-4-one

Formula: C₁₈H₁₈O₅

Purezza: 99%

Peso molecolare: 314.33

Ref: IN-DG235862

Naringenin trimethyl ether

CAS: 38302-15-7

1. Naringenin trimethyl ether (5,7,4'-Trimethoxyflavanone) shows significant molluscicidal activity with a median lethal concentration (LC(5)) of 3.9 μg/mL.

Formula: C₁₈H₁₈O₅

Purezza: 99.91%

Colore e forma: Solid

Peso molecolare: 314.33

Ref: TM-T2S2169