CAS 403848-57-7

Formula: C24H35ClN6O9

InChI: InChI=1S/C24H35ClN6O9/c1-12(2)6-17(28-13(3)32)23(39)29-15(4-5-20(34)35)22(38)31-18(7-14-10-26-11-27-14)24(40)30-16(8-21(36)37)19(33)9-25/h10-12,15-18H,4-9H2,1-3H3,(H,26,27)(H,28,32)(H,29,39)(H,30,40)(H,31,38)(H,34,35)(H,36,37)/t15-,16-,17-,18-/m0/s1

InChI key: JSRLQUNMFYXVQD-XSLAGTTESA-N

SMILES: CC(C)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@@H](CC(=O)O)C(=O)CCl)NC(=O)C

N-Acetyl-L-leucyl-L-α-glutamyl-N-[(1S)-1-(carboxymethyl)-3-chloro-2-oxopropyl]-L-histidinamide

CAS: 403848-57-7

N-Acetyl-L-leucyl-L-α-glutamyl-N-[(1S)-1-(carboxymethyl)-3-chloro-2-oxopropyl]-L-histidinamide

Formula: C₂₄H₃₅ClN₆O₉

Purezza: ≥95%

Peso molecolare: 587.02

Ref: 54-OR1138222

N-Acetyl-L-leucyl-L-α-glutamyl-N-[(1S)-1-(carboxymethyl)-3-chloro-2-oxopropyl]-L-histidinamide

CAS: 403848-57-7

Formula: C₂₄H₃₅ClN₆O₉

Purezza: 98%

Peso molecolare: 587.0225

Ref: IN-DA00C5QG

Caspase-9 Inhibitor III

CAS: 403848-57-7

Caspase-9 Inhibitor III (Ac-LEHD-cmk) blocks caspase-9, protects against ischemic heart damage.

Formula: C₂₄H₃₅ClN₆O₉

Colore e forma: Solid

Peso molecolare: 587.02

Ref: TM-T72281

Ac-Leu-Glu-His-Asp-chloromethylketone

CAS: 403848-57-7

Ac-Leu-Glu-His-Asp-chloromethylketone is a creatine kinase inhibitor that prevents the conversion of ATP to ADP. It inhibits mitochondrial pathways, leading to apoptotic and proapoptotic effects. Ac-Leu-Glu-His-Asp-chloromethylketone also has a kinetic effect on cells, where it causes necrotic cell death. This compound can cause proteolytic activity, which leads to the activation of caspase 9 and matrix metalloproteinases. Ac-Leu-Glu-His-Asp chloromethylketone has been shown to have antiinflammatory properties in cellular assays, as well as an ability to inhibit the synthesis of cellular proteins.

Formula: C₂₄H₃₅ClN₆O₉

Purezza: Min. 95%

Peso molecolare: 587.02 g/mol

Ref: 3D-FA111088