CAS 4530-21-6

Formula: C35H61N3O9

InChI: InChI=1S/C35H61N3O9/c1-16-22(11)25-34(43)46-27(19(5)6)30(39)36(13)24(18(3)4)33(42)45-28(20(7)8)31(40)37(14)26(23(12)17-2)35(44)47-29(21(9)10)32(41)38(25)15/h18-29H,16-17H2,1-15H3/t22-,23-,24-,25-,26-,27+,28+,29+/m0/s1

InChI key: OWUREPXBPJFMOK-CIRFPNLUSA-N

SMILES: CC[C@H](C)[C@H]1C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)[C@@H](C)CC)C)C(C)C)C(C)C)C)C(C)C

Enniatin A1

CAS: 4530-21-6

Enniatin A1

Formula: C₃₅H₆₁N₃O₉

Peso molecolare: 667.87354

Ref: 54-BI12138

Enniatin A1

CAS: 4530-21-6

Enniatin A1, a cyclic hexadepsipeptide from Fusarium, induces apoptosis and disrupts ERK, inhibiting ACAT (IC50: 49 μM).

Formula: C₃₅H₆₁N₃O₉

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 667.8735

Ref: TM-T11201

Enniatin A1

CAS: 4530-21-6

Formula: C₃₅H₆₁N₃O₉

Purezza: 98%

Peso molecolare: 667.8735

Ref: IN-DA00DKMU

Enniatin A1

CAS: 4530-21-6

Ref: 7W-GW9382

Enniatin A1

CAS: 4530-21-6

Formula: C₃₅H₆₁N₃O₉

Peso molecolare: 667.89

Ref: 4Z-PE-171003

Enniatin A1 in Acetonitrile

CAS: 4530-21-6

Acetonitrile

Formula: C₃₅H₆₁N₃O₉

Peso molecolare: 667.9

Ref: BE-Bepure-25982LA-10

Enniatin A1 in Acetonitrile

CAS: 4530-21-6

Acetonitrile

Formula: C₃₅H₆₁N₃O₉

Peso molecolare: 667.9

Ref: BE-Bepure-25982XA-100

Enniatin A1

CAS: 4530-21-6

Enniatin A1 is a cyclic hexadepsipeptide, which is a secondary metabolite produced by various Fusarium species. This compound is primarily derived from Fusarium fungi and exhibits notable bioactivity due to its ionophoric properties. The mode of action involves its ability to disrupt ion gradients across cellular membranes. Enniatin A1 functions by forming complexes with cations, particularly alkali and alkaline earth metal ions, facilitating their transport across lipid membranes and ultimately perturbing cellular homeostasis.

Purezza: Min. 95%

Ref: 3D-BE162721