CAS 53784-83-1

Formula: C42H63Br7O28

InChI: InChI=1S/C42H63Br7O28/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51/h8-42,50-63H,1-7H2/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-/m1/s1

InChI key: XNNRROJOWZLYCK-FOUAGVGXSA-N

SMILES: C([C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]5[C@H](O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]7[C@H](O[C@@H]([C@@H]([C@H]7O)O)O[C@@H]8[C@H](O[C@H](O2)[C@@H]([C@H]8O)O)CBr)CBr)CBr)CBr)CBr)CBr)O)O)Br

Heptakis(6-deoxy-6-bromo)-β-cyclodexrin

CAS: 53784-83-1

Heptakis(6-deoxy-6-bromo)-β-cyclodexrin

Purezza: 98%

Ref: 54-BICY1018

Heptakis(6-Bromo-6-Deoxy)-β-Cyclodextrin

CAS: 53784-83-1

Formula: C₄₂H₆₃Br₇O₂₈

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 1575.2608

Ref: IN-DA00DCXR

6-Bromo-6-deoxy-b-cyclodextrin

CAS: 53784-83-1

Heptakis(6-Bromo-6-Deoxy)-β-Cyclodextrin

Formula: C₄₂H₆₃Br₇O₂₈

Purezza: 98%

Peso molecolare: 1575.26

Ref: IN-DG303997

Sugammadex Impurity 68

CAS: 53784-83-1

Formula: C₄₂H₆₃Br₇O₂₈

Peso molecolare: 1575.27

Ref: 4Z-S-082071

Heptakis(6-bromo-6-deoxy)-β-cyclodextrin

Prodotto controllato

CAS: 53784-83-1

Formula: C₄₂H₆₃Br₇O₂₈

Colore e forma: Neat

Peso molecolare: 1575.27

Ref: TR-H280900

Sugammadex Impurity 68

CAS: 53784-83-1

Formula: C₄₂H₆₃Br₇O₂₈

Peso molecolare: 1575.27

Ref: ST-EA-CP-S32069

6-Bromo-6-deoxy-b-cyclodextrin

CAS: 53784-83-1

This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.

Formula: C₄₂H₆₃Br₇O₂₈

Purezza: Min. 95%

Colore e forma: White Powder

Peso molecolare: 1,575.26 g/mol

Ref: 3D-OB44674