CAS 61715-72-8: 1-ethyl-1-(4-methylphenyl)hydrazine
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-3-11(10)9-6-4-8(2)5-7-9/h4-7H,3,10H2,1-2H3
- Sinonimi:
- Hydrazine, 1-Ethyl-1-(4-Methylphenyl)-
| Marchio | Dati del prodotto | Purezza | Fascia di prezzo | Consegna prevista |
|---|---|---|---|---|
 | 1-Ethyl-1-(p-tolyl)hydrazine REF: IN-DA003EAFCAS: 61715-72-8 | - - - | Prezzo su richiesta | Lun 03 Mar 25 |
 | 1-Ethyl-1-(4-methylphenyl)hydrazine REF: 54-OR919938CAS: 61715-72-8 | 95% | 187,00 €~645,00 € | Lun 10 Mar 25 |
 | 1-Ethyl-1-(p-tolyl)hydrazine REF: 10-F724434CAS: 61715-72-8 | 95+% | - - - | Prodotto fuori produzione |
 | 1-Ethyl-1-(4-methylphenyl)hydrazine REF: 3D-LCA71572CAS: 61715-72-8 | Min. 95% | - - - | Prodotto fuori produzione |
Ref: IN-DA003EAF
| Dimensione non definita | Prezzo su richiesta |
Consegna stimata in Stati Uniti, il Lunedì 03 Marzo 2025
Ref: 54-OR919938
| 1g | 187,00 € | ||
| 5g | 418,00 € | ||
| 10g | 645,00 € |
Consegna stimata in Stati Uniti, il Lunedì 10 Marzo 2025
Ref: 10-F724434
| 5g | Fuori produzione | Richiedi informazioni | |
| 25g | Fuori produzione | Richiedi informazioni |
1-Ethyl-1-(4-methylphenyl)hydrazine
CAS:61715-72-8
1-Ethyl-1-(4-methylphenyl)hydrazine is an indole derivative that can be used for the synthesis of arylhydrazones. This …
Formula:
C9H14N2
Purezza:
Min. 95%
Peso molecolare:
150.23 g/mol
Ref: 3D-LCA71572
| 1g | Fuori produzione | Richiedi informazioni | |
| 5g | Fuori produzione | Richiedi informazioni | |
| 10g | Fuori produzione | Richiedi informazioni | |
| 25g | Fuori produzione | Richiedi informazioni | |
| 50g | Fuori produzione | Richiedi informazioni |
