CAS 83247-73-8

Formula: C20H24O7

InChI: InChI=1S/C20H24O7/c1-6-11(2)19(23)27-17(18(22)20(3,4)24)13-9-12-7-8-16(21)26-14(12)10-15(13)25-5/h6-10,17-18,22,24H,1-5H3/b11-6+/t17-,18-/m1/s1

InChI key: BAHUBXAYVOCLNA-OEQDPHDDSA-N

SMILES: C/C=C(\C)/C(=O)O[C@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)[C@H](C(C)(C)O)O

Angelol H

CAS: 83247-73-8

Angelol H

Peso molecolare: 376.15

Ref: 10-F566357

Angelol H

CAS: 83247-73-8

Angelol H is a natural product from Angelica sinensis.

Formula: C₂₀H₂₄O₇

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 376.4004

Ref: TM-TN3415

Angelol H

CAS: 83247-73-8

Angelol H is a phytochemical compound, which is a naturally derived product extracted from the roots of certain plant species belonging to the Angelica genus. The source of Angelol H includes various species traditionally used in herbal medicine, known for their bioactive constituents.

Formula: C₂₀H₂₄O₇

Purezza: Min. 95%

Peso molecolare: 376.40 g/mol

Ref: 3D-IDA24773