CAS 83946-90-1

Formula: C26H30O13

InChI: InChI=1S/C26H30O13/c1-35-24(34)15-11-36-25(39-26-23(33)22(32)21(31)17(10-28)38-26)19-13(9-27)8-16(20(15)19)37-18(30)7-4-12-2-5-14(29)6-3-12/h2-8,11,16-17,19-23,25-29,31-33H,9-10H2,1H3/b7-4+/t16-,17-,19-,20+,21-,22+,23-,25+,26+/m1/s1

InChI key: ABYPZHZWILXERF-BYMAQSFPSA-N

SMILES: COC(=O)C1=CO[C@H]([C@H]2[C@@H]1[C@@H](C=C2CO)OC(=O)/C=C/C3=CC=C(C=C3)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O

6-O-p-Coumaroyl scandoside methyl ester

CAS: 83946-90-1

6-O-p-Coumaroyl scandoside methyl ester

Peso molecolare: 550.17

Ref: 10-F562851

(E)-6-O-p-Coumaroyl scandoside methyl ester

CAS: 83946-90-1

(E)-6-O-p-Coumaroyl scandoside methyl ester

Formula: C₂₆H₃₀O₁₃

Purezza: 99.5%

Peso molecolare: 550.51

Ref: 54-BUP23962

(E)-6-O-p-Coumaroyl scandoside methyl ester

CAS: 83946-90-1

(E)-6-O-(p-coumaroyl)scandoside methyl ester shows moderate anti-proliferation effect on PC3 human androgen-independent prostate cancer cells.

Formula: C₂₆H₃₀O₁₃

Purezza: 99.92%

Colore e forma: White Solid

Peso molecolare: 550.5086

Ref: TM-TN6638

(E)-6-o-(p-Coumaroyl)scandoside methyl ester

CAS: 83946-90-1

(E)-6-o-(p-Coumaroyl)scandoside methyl ester is a bioactive compound classified as a phenolic ester. It is primarily derived from plants and is notably found in certain medicinal herbs. The compound is a phytochemical, a category of naturally occurring plant metabolites known for their roles in plant defense and potential health benefits for humans.

Formula: C₂₆H₃₀O₁₃

Purezza: Min. 95%

Peso molecolare: 550.5 g/mol

Ref: 3D-IDA94690