CAS 84709-25-1

Formula: C20H20O5

InChI: InChI=1S/C20H20O5/c1-11-12(2)20(14-4-6-16-18(8-14)24-10-22-16)25-19(11)13-3-5-15-17(7-13)23-9-21-15/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12+,19-,20-/m0/s1

InChI key: QFUXQRHAJWXPGP-YLYZPZNOSA-N

SMILES: C[C@@H]1[C@@H]([C@H](O[C@@H]1C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)C

d-Epigalbacin

CAS: 84709-25-1

d-Epigalbacin

Formula: C₂₀H₂₀O₅

Purezza: 99.5%

Peso molecolare: 340.37

Ref: 54-BUP05069

d-Epigalbacin

CAS: 84709-25-1

d-Epigalbacin ((-)-Zuonin A) is a naturally occurring lignin.

Formula: C₂₀H₂₀O₅

Purezza: 99.91%

Colore e forma: White Solid

Peso molecolare: 340.3698

Ref: TM-TN7121

d-Epigalbacin

CAS: 84709-25-1

Formula: C₂₀H₂₀O₅

Peso molecolare: 340.38

Ref: 7W-GY1980

d-Epigalbacin

CAS: 84709-25-1

Formula: C₂₀H₂₀O₅

Purezza: 95%~99%

Peso molecolare: 340.375

Ref: BP-BP4469

5,5′-[(2S,3R,4S,5S)-Tetrahydro-3,4-dimethyl-2,5-furandiyl]bis[1,3-benzodioxole]

CAS: 84709-25-1

Formula: C₂₀H₂₀O₅

Purezza: 95%

Colore e forma: Solid

Peso molecolare: 340.3698

Ref: IN-DA01V7EE

(-)-Zuonin A

CAS: 84709-25-1

(-)-Zuonin A is a naturally occurring triterpenoid saponin, which is derived from plants, particularly those within the Cucurbitaceae family. This compound is characterized by its complex glycosidic structure, typical of saponins, which contributes to its bioactive properties. The mode of action of (-)-Zuonin A is primarily through the modulation of cell signaling pathways, leading to the induction of apoptosis in cancer cells and the inhibition of tumor growth. Its mechanism involves interactions with cell membranes and proteins, affecting cellular homeostasis and signaling cascades.

Formula: C₂₀H₂₀O₅

Purezza: Min. 95%

Peso molecolare: 340.4 g/mol

Ref: 3D-JDA70925