CAS 849727-88-4

Formula: C16H14O5

InChI: InChI=1S/C16H14O5/c17-11-3-1-9(2-4-11)5-10-8-21-14-7-12(18)6-13(19)15(14)16(10)20/h1-4,6-7,10,17-19H,5,8H2/t10-/m1/s1

InChI key: FIASLUPJXGTCKM-SNVBAGLBSA-N

SMILES: C1[C@H](C(=O)C2=C(C=C(C=C2O1)O)O)CC3=CC=C(C=C3)O

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-o

CAS: 849727-88-4

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-o

Formula: C₁₆H₁₄O₅

Purezza: ≥98%

Peso molecolare: 286.28

Ref: 54-OR1104587

(R)-(4′-Hydroxy)-5,7-dihydroxy-4-chromanone

CAS: 849727-88-4

(R)-(4′-Hydroxy)-5,7-dihydroxy-4-chromanone, an antiangiogenic homoisoflavonoid, exhibits activity against human retinal microvascular endothelial cells.

Formula: C₁₆H₁₄O₅

Colore e forma: Solid

Peso molecolare: 286.2794

Ref: TM-T40942

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-one

CAS: 849727-88-4

Formula: C₁₆H₁₄O₅

Purezza: 95%~99%

Peso molecolare: 286.283

Ref: BP-BP4916

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-o

CAS: 849727-88-4

Formula: C₁₆H₁₄O₅

Purezza: 98%

Peso molecolare: 286.2794

Ref: IN-DA023IIJ

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-one

CAS: 849727-88-4

(3R)-2,3-Dihydro-5,7-dihydroxy-3-[(4-hydroxyphenyl)methyl]-4H-1-benzopyran-4-one is a naturally occurring flavonoid, which is primarily sourced from various plants including fruits, herbs, and vegetables. This compound exhibits a range of biological activities associated with its structural attributes. The compound acts through its antioxidant mechanism, wherein it scavenges reactive oxygen species, thus mitigating oxidative stress and preventing cellular damage. Additionally, it can modulate signaling pathways involved in inflammation, apoptosis, and cell proliferation.

Formula: C₁₆H₁₄O₅

Purezza: Min. 95%

Peso molecolare: 286.28 g/mol

Ref: 3D-ZIB72788