CAS 879290-97-8

Formula: C18H24O3

InChI: InChI=1S/C18H24O3/c1-5-18(4)11-10-15(12(2)3)21-17(18)16(20)13-6-8-14(19)9-7-13/h5-9,15-17,19-20H,1-2,10-11H2,3-4H3/t15-,16-,17?,18+/m0/s1

InChI key: VLFQGDGCZKMBDA-UKSPMXFCSA-N

SMILES: CC(=C)[C@@H]1CC[C@@](C(O1)[C@H](C2=CC=C(C=C2)O)O)(C)C=C

Psoracorylifol A

CAS: 879290-97-8

Psoracorylifol A is a high-purity biochemical reagent suitable for biochemical experiments and drug synthesis research.

Formula: C₁₈H₂₄O₃

Colore e forma: Solid

Peso molecolare: 288.39

Ref: TM-T124017

Psoracorylifol A

CAS: 879290-97-8

Psoracorylifol A is a naturally occurring compound that is categorized as a bioactive phytochemical. It is derived primarily from the seeds of Psoralea corylifolia, a plant known for its diverse medicinal properties. This compound functions by interacting with multiple biological pathways, exerting effects such as anti-inflammatory and antioxidant activities.

Formula: C₁₈H₂₄O₃

Purezza: Min. 95%

Peso molecolare: 288.4 g/mol

Ref: 3D-EKB29097