CAS 879324-77-3

Formula: C20H24O4

InChI: InChI=1S/C20H24O4/c1-11(2)14-10-13-7-6-12(3)16(17(13)19(23)18(14)22)15(21)8-9-20(4,5)24/h6-7,10-11,24H,8-9H2,1-5H3

InChI key: OCTDHGFZGVITEW-UHFFFAOYSA-N

SMILES: CC1=C(C2=C(C=C1)C=C(C(=O)C2=O)C(C)C)C(=O)CCC(C)(C)O

Prionoid D

CAS: 879324-77-3

Prionoid D is a synthetic compound, which is meticulously designed to inhibit the pathological replication of prions. Its underlying structure draws influence from both computational chemistry and extensive molecular biology studies to mimic key binding sites affected during prion propagation. Prionoid D specifically interacts with misfolded prion proteins, aiming to stabilize their structure and prevent further pathological aggregation. This mode of action primarily targets the structural conversion mechanism that facilitates prion replication and spread.

Formula: C₂₀H₂₄O₄

Purezza: Min. 95%

Peso molecolare: 328.4 g/mol

Ref: 3D-EKB32477