CAS 879324-78-4

Formula: C20H22O4

InChI: InChI=1S/C20H22O4/c1-11(2)14-10-13-7-6-12(3)16(17(13)19(23)18(14)22)15(21)8-9-20(4,5)24/h6-11,24H,1-5H3/b9-8+

InChI key: QRIJFKANMJMVFQ-CMDGGOBGSA-N

SMILES: CC1=C(C2=C(C=C1)C=C(C(=O)C2=O)C(C)C)C(=O)/C=C/C(C)(C)O

Prionoid E

CAS: 879324-78-4

Prionoid E is a synthetic compound, which is derived from advanced chemical synthesis techniques designed to mimic natural molecular interactions. It operates through the targeted modulation of protein folding pathways, specifically inhibiting the aggregation of misfolded proteins. By stabilizing specific protein conformations, Prionoid E disrupts pathogenic prion-like propagation that contributes to neurodegenerative conditions.

Formula: C₂₀H₂₂O₄

Purezza: Min. 95%

Peso molecolare: 326.4 g/mol

Ref: 3D-EKB32478