CAS 945259-61-0

Formula: C22H26O12

InChI: InChI=1S/C22H26O12/c1-29-13-8-11(23)4-5-12(13)33-22-20(27)19(26)18(25)16(34-22)9-32-21(28)10-6-14(30-2)17(24)15(7-10)31-3/h4-8,16,18-20,22-27H,9H2,1-3H3/t16-,18-,19+,20-,22?/m1/s1

InChI key: ZPJXHZWSVVTKED-GWNCWCLRSA-N

SMILES: COC1=CC(=CC(=C1O)OC)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H](C(O2)OC3=C(C=C(C=C3)O)OC)O)O)O

4-Hydroxy-2-methoxyphenol 1-O-(6-O-syringoyl)glucoside

CAS: 945259-61-0

Formula: C₂₂H₂₆O₁₂

Peso molecolare: 482.4346

Ref: IN-DA01DNQL

4-Hydroxy-2-methoxyphenol 1-O-(6-O-syringoyl)glucoside

CAS: 945259-61-0

Formula: C₂₂H₂₆O₁₂

Purezza: 95%~99%

Colore e forma: Powder

Peso molecolare: 482.438

Ref: BP-SBP02167

4-Hydroxy-2-methoxyphenol 1-O-(6-O-syringoyl)glucoside

CAS: 945259-61-0

4-Hydroxy-2-methoxyphenol 1-O-(6-O-syringoyl)glucoside is a phenolic glycoside, which is derived from plant sources, particularly in certain tree barks and leaves known for their rich polyphenolic content. This compound is a conjugate of glucoside and syringoyl moieties, contributing to its unique structural and functional properties. The mode of action of this compound involves its ability to act as an antioxidant, likely through electron donation that neutralizes free radicals, thereby mitigating oxidative stress within biological systems.

Formula: C₂₂H₂₆O₁₂

Purezza: Min. 95%

Peso molecolare: 482.43 g/mol

Ref: 3D-OH44164