CAS 946513-19-5

Formula: C26H26ClN2NaO3S2

InChI: InChI=1S/C26H27ClN2O3S2.Na/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22;/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32);/q;+1/p-1/b10-6+;

InChI key: XNAYQOBPAXEYLI-AAGWESIMSA-M

SMILES: CN(C)C(=O)CCSC(C1=CC=CC(=C1)/C=C/C2=NC3=C(C=CC(=C3)Cl)C=C2)SCCC(=O)[O-].[Na+]

alfa-Phenyllongifolol

CAS: 946513-19-5

Formula: C₂₁H₃₀O

Peso molecolare: 298.47

Ref: 4Z-I-183003

Alpha-Phenyllongifolol

Prodotto controllato

CAS: 946513-19-5

Applications α-Phenyllongifolol is an impurity in the synthesis of Longifolene (L469455) which is a constituent of black cumin seed and may exhibit anticancer and antibacterial activities.
References Hajhashemi, V., et al.: Phytother. Res 18, 195 (2004); Bourgou, S., et al.: S Afr J Bot 76, 210 (2010)

Formula: C₂₁H₃₀O

Colore e forma: Neat

Peso molecolare: 298.46

Ref: TR-P335530

α-Phenyllongifolol

CAS: 946513-19-5

α-Phenyllongifolol is a sesquiterpenoid compound, which is derived primarily from certain plant species known for their essential oil production. This compound is biosynthesized through the mevalonate pathway, a critical metabolic route in plants responsible for terpene production. The mode of action of α-Phenyllongifolol involves disrupting microbial cell membranes, exhibiting potent antimicrobial properties. It interferes with the lipid bilayer, leading to increased permeability and, subsequently, cell death.

Formula: C₂₁H₃₀O

Purezza: Min. 95%

Peso molecolare: 298.46 g/mol

Ref: 3D-WMB51319