CAS 948573-97-5

Formula: C21H24N2O10

InChI: InChI=1S/C21H24N2O10/c1-10-7-12(29-3)8-13(30-4)16(10)20(27)33-17-14(9-24)32-19(18(17)31-11(2)25)23-6-5-15(26)22-21(23)28/h5-8,14,17-19,24H,9H2,1-4H3,(H,22,26,28)/t14-,17-,18-,19-/m1/s1

InChI key: MAWCJLLSYLMLHT-UTRMSSBJSA-N

SMILES: CC1=CC(=CC(=C1C(=O)O[C@@H]2[C@H](O[C@H]([C@@H]2OC(=O)C)N3C=CC(=O)NC3=O)CO)OC)OC

Kipukasin A

CAS: 948573-97-5

Kipukasin A is a secondary metabolite produced by the bacterium *Streptomyces* species, which is a genus well-known for its rich capacity to produce bioactive compounds. The source of this compound is a soil-dwelling microorganism, which is often explored for its diverse and potent natural products. Kipukasin A operates by inhibiting specific bacterial enzymes, disrupting essential pathways necessary for bacterial cell survival and replication. This mode of action indicates its potential as an antibacterial agent.

Formula: C₂₁H₂₄N₂O₁₀

Purezza: Min. 95%

Peso molecolare: 464.42 g/mol

Ref: 3D-YMB57397