CAS 949467-71-4

Formula: C26H48N8O2

InChI: InChI=1S/C26H48N8O2/c1-17(2)13-33(14-18(3)4)23-21-22(30-25(31-23)27-9-11-35)24(32-26(29-21)28-10-12-36)34(15-19(5)6)16-20(7)8/h17-20,35-36H,9-16H2,1-8H3,(H,27,30,31)(H,28,29,32)

InChI key: KIZLZYHFIWWKIL-UHFFFAOYSA-N

SMILES: CC(C)CN(CC(C)C)C1=NC(=NC2=C1N=C(N=C2N(CC(C)C)CC(C)C)NCCO)NCCO

TC-T 6000

CAS: 949467-71-4

TC-T 6000

Formula: C₂₆H₄₈N₈O₂

Purezza: ≥98%

Peso molecolare: 504.71

Ref: 54-BUP21767

hENT4-IN-1

CAS: 949467-71-4

Formula: C₂₆H₄₈N₈O₂

Purezza: 98%

Peso molecolare: 504.7117

Ref: IN-DA01ENLN

2,2'-((4,8-Bis(diisobutylamino)pyrimido[5,4-d]pyrimidine-2,6-diyl)bis(azanediyl))diethanol

CAS: 949467-71-4

Formula: C₂₆H₄₈N₈O₂

Purezza: 99%

Peso molecolare: 504.71

Ref: IN-DG01253410

TC-T 6000

Prodotto controllato

CAS: 949467-71-4

Formula: C₂₆H₄₈N₈O₂

Colore e forma: Neat

Peso molecolare: 504.712

Ref: TR-T127755

TC-T 6000

CAS: 949467-71-4

TC-T 6000 is an advanced chemical compound synthesized from sustainable raw materials, designed to enhance industrial processes. As a high-performance additive, TC-T 6000 acts through its unique molecular structure, facilitating efficient catalysis and improving reaction kinetics in various chemical processes. This product is known for its stability and effectiveness under diverse conditions, making it a versatile tool for researchers and engineers.

Formula: C₂₆H₄₈N₈O₂

Purezza: Min. 95%

Peso molecolare: 504.7 g/mol

Ref: 3D-ZMB46771

TC-T 6000

CAS: 949467-71-4

TC-T 6000 (hENT4-IN-1) is an ENT4 inhibitor with vasodilator activity that inhibits hENT1 and hENT2 for the study of cancer and cardiovascular damage.

Formula: C₂₆H₄₈N₈O₂

Purezza: 98.14%

Colore e forma: Yellow Solid

Peso molecolare: 504.71

Ref: TM-T34793