CAS 950834-06-7

Formula: C7H9NO5S2

InChI: InChI=1S/C7H9NO5S2/c1-14(10,11)6-4-2-3-5-7(6)15(12,13)8-9/h2-5,8-9H,1H3

InChI key: RZRWBKKAFHXNEQ-UHFFFAOYSA-N

SMILES: CS(=O)(=O)C1=CC=CC=C1S(=O)(=O)NO

N-Hydroxy-2-(methylsulfonyl)benzenesulfonamide

CAS: 950834-06-7

N-Hydroxy-2-(methylsulfonyl)benzenesulfonamide (NHMSB) is a promising anticancer agent with potent apoptotic activity. It is an analog of the tumor suppressor protein p53, which plays a crucial role in regulating the cell cycle and preventing cancer development. NHMSB has been shown to induce apoptosis in various human cancer cell lines, including Chinese hamster ovary cells and breast cancer cells. This medicinal compound acts as a kinase inhibitor, blocking the activity of enzymes that promote cell proliferation and survival. NHMSB also inhibits the growth of tumors in vivo and has potential for use as an anticancer drug.

Formula: C₇H₉NO₅S₂

Purezza: Min. 95%

Peso molecolare: 251.3 g/mol

Ref: 3D-ANB83406

CXL-1020

CAS: 950834-06-7

CXL-1020, a HNO prodrug, enhances heart muscle function & relaxation, aiding in heart failure research.

Formula: C₇H₉NO₅S₂

Colore e forma: Solid

Peso molecolare: 251.28

Ref: TM-T60377