CAS 955083-90-6

Formula: C26H37NO2

InChI: InChI=1S/C26H37NO2/c1-8-17(5)22-18(6)14-26(7)13-16(4)9-10-21(26)23(22)24(28)20-12-19(11-15(2)3)27-25(20)29/h8,11-12,14-16,21-23H,9-10,13H2,1-7H3,(H,27,29)/b17-8+,19-11-/t16-,21+,22-,23+,26+/m1/s1

InChI key: TXVWNUBEANXHMB-FXVWVMPXSA-N

SMILES: C/C=C(\C)/[C@H]1[C@H]([C@@H]2CC[C@H](C[C@]2(C=C1C)C)C)C(=O)C3=C/C(=C/C(C)C)/NC3=O

Myceliothermophin E

CAS: 955083-90-6

Formula: C₂₆H₃₇NO₂

Purezza: 93.45%

Colore e forma: White. Solid

Peso molecolare: 395.0

Ref: 8R-AD0066

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E, from T. thermophilus, is a polyketide-amino acid compound with anticancer and anti-MRSA activities.

Formula: C₂₆H₃₇NO₂

Colore e forma: Solid

Peso molecolare: 395.5775

Ref: TM-T35690

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E

Colore e forma: Solid

Peso molecolare: 0.00g/mol

Ref: 54-BIBR1133

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E is a novel enzyme, which is derived from genetically modified strains of thermophilic fungi. This enzyme operates through a highly efficient catalytic mechanism that specifically targets and degrades fungal hyphae cell walls. The enzymatic action involves hydrolyzing chitin and other polysaccharides, thereby disrupting the structural integrity of fungal cells.

Formula: C₂₆H₃₇NO₂

Purezza: Min. 95%

Peso molecolare: 395.60 g/mol

Ref: 3D-FNB08390