CAS 95645-52-6

Formula: C16H24O7

InChI: InChI=1S/C16H24O7/c1-7(2)9-5-11(8(3)4-10(9)18)22-16-15(21)14(20)13(19)12(6-17)23-16/h4-5,7,12-21H,6H2,1-3H3/t12-,13-,14+,15-,16-/m1/s1

InChI key: XFPSRAYOBUHKRV-IBEHDNSVSA-N

SMILES: CC1=CC(=C(C=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(C)C)O

Zataroside B

CAS: 95645-52-6

Zataroside B is a novel marine-derived compound, which is a potent cytotoxic agent sourced primarily from marine sponge extracts. Its mode of action involves the disruption of microtubule dynamics, leading to the inhibition of mitotic spindle formation and ultimately inducing apoptosis in cancer cells. The specificity of Zataroside B towards disrupting cancer cell proliferation while sparing healthy cells makes it a promising candidate for anti-cancer therapy research. Studies investigating Zataroside B focus on its application in the treatment of various aggressive cancers, including metastatic and drug-resistant forms. Due to its unique mechanism and marine origin, it represents a new frontier in natural product pharmacology with potential implications in developing targeted therapies.

Formula: C₁₆H₂₄O₇

Purezza: Min. 95%

Peso molecolare: 328.36 g/mol

Ref: 3D-VDA64552