CAS 95733-02-1

Formula: C30H22O10

InChI: InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)28-22(37)11-18-19(34)12-23-25(30(18)40-28)26(29(39-23)14-3-7-16(32)8-4-14)27(38)24-20(35)9-17(33)10-21(24)36/h1-10,12,22,28,31-37H,11H2/t22-,28+/m0/s1

InChI key: JBNFGJOTOPTIDE-RBISFHTESA-N

SMILES: C1[C@@H]([C@H](OC2=C1C(=CC3=C2C(=C(O3)C4=CC=C(C=C4)O)C(=O)C5=C(C=C(C=C5O)O)O)O)C6=CC=C(C=C6)O)O

[(2r,3s)-3,5-dihydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2h-furo[2,3-h]chromen-9-yl](2,4,6-trihydroxyphenyl)methanone

CAS: 95733-02-1

[(2r,3s)-3,5-dihydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2h-furo[2,3-h]chromen-9-yl](2,4,6-trihydroxyphenyl)methanone

Formula: C₃₀H₂₂O₁₀

Purezza: ≥98%

Peso molecolare: 542.49

Ref: 54-OR1104596

Daphnodorin B

CAS: 95733-02-1

Daphnodorin B is a useful organic compound for research related to life sciences and the catalog number is T123854.

Formula: C₃₀H₂₂O₁₀

Colore e forma: Solid

Peso molecolare: 542.49

Ref: TM-T123854

[(2r,3s)-3,5-dihydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2h-furo[2,3-h]chromen-9-yl](2,4,6-trihydroxyphenyl)methanone

CAS: 95733-02-1

Formula: C₃₀H₂₂O₁₀

Purezza: 98%

Peso molecolare: 542.4897

Ref: IN-DA006BKI

Daphnodorin B

CAS: 95733-02-1

Daphnodorin B is a bioactive compound, which is a natural product isolated from the plant genus Daphne, known for its rich variety of phytochemicals. It functions primarily through its apoptotic and anti-inflammatory modes of action, making it of significant interest to researchers in pharmacology and medicinal chemistry. As a biflavonoid compound, Daphnodorin B can induce apoptosis in cancerous cells by activating the caspase pathway and altering mitochondrial membrane potentials. This action is crucial for studying how naturally derived compounds can be harnessed for therapeutic interventions in oncology.

Formula: C₃₀H₂₂O₁₀

Purezza: Min. 95%

Peso molecolare: 542.50 g/mol

Ref: 3D-VDA73302