CAS 97411-46-6

Formula: C18H16O5

InChI: InChI=1S/C18H16O5/c1-9-7-23-17-11-4-5-12-10(3-2-6-18(12,22)8-19)14(11)16(21)15(20)13(9)17/h4-5,7,19,22H,2-3,6,8H2,1H3/t18-/m1/s1

InChI key: TZHMQUSSYNZSTA-GOSISDBHSA-N

SMILES: CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCC[C@]4(CO)O

Tanshindiol A

CAS: 97411-46-6

Tanshindiol A

Peso molecolare: 312.1

Ref: 10-F560411

(6S)-6-hydroxy-6-(hydroxymethyl)-1-methyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione

CAS: 97411-46-6

(6S)-6-hydroxy-6-(hydroxymethyl)-1-methyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione

Formula: C₁₈H₁₆O₅

Purezza: ≥98%

Peso molecolare: 312.32

Ref: 54-OR1126006

Tanshindiol A

CAS: 97411-46-6

Tanshindiol A is a natural product of Salvia, Lamiaceae.

Formula: C₁₈H₁₆O₅

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 312.3166

Ref: TM-TN5095

(6S)-6-hydroxy-6-(hydroxymethyl)-1-methyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione

CAS: 97411-46-6

Formula: C₁₈H₁₆O₅

Purezza: 98%

Peso molecolare: 312.3166

Ref: IN-DA01FZ03

Tanshindiol A

CAS: 97411-46-6

Tanshindiol A is a bioactive compound, which is derived from the roots of Salvia miltiorrhiza, a plant widely used in traditional Chinese medicine. This compound is known for its pharmacological properties, acting primarily through the modulation of various biological pathways, including anti-inflammatory and antioxidant mechanisms. Tanshindiol A exhibits these effects by influencing the expression of specific enzymes and signaling molecules, thereby contributing to its therapeutic potential.

Formula: C₁₈H₁₆O₅

Purezza: Min. 95%

Peso molecolare: 312.30 g/mol

Ref: 3D-XDA41146