CAS 98113-96-3

Formula: C20H16O6

InChI: InChI=1S/C20H16O6/c1-9(2)3-5-11-13(22)8-15-17(18(11)23)19(24)16-12-6-4-10(21)7-14(12)25-20(16)26-15/h3-4,6-8,21-23H,5H2,1-2H3

InChI key: NOYRXEKDLRHOOL-UHFFFAOYSA-N

SMILES: CC(=CCC1=C(C2=C(C=C1O)OC3=C(C2=O)C4=C(O3)C=C(C=C4)O)O)C

Lupinalbin B

CAS: 98113-96-3

Lupinalbin B is a bioactive compound, specifically classified as an alkaloid, which is derived from the seeds of the Lupinus plant species. These plants, commonly known as lupins, are a part of the legume family and are cultivated primarily for their seeds that contain high protein content. The presence of alkaloids like Lupinalbin B in lupin seeds is a result of the plant's secondary metabolism, which serves various ecological functions, including defense against herbivores.

Formula: C₂₀H₁₆O₆

Purezza: (%) Min. 95%

Colore e forma: Powder

Peso molecolare: 352.34 g/mol

Ref: 3D-XL161802