CAS 98206-80-5

Formula: C18H33NO3

InChI: InChI=1S/C18H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)19-16-14-15-22-18(16)21/h16H,2-15H2,1H3,(H,19,20)

InChI key: ZQAYHOXXVBVXPZ-UHFFFAOYSA-N

SMILES: CCCCCCCCCCCCCC(=O)NC1CCOC1=O

N-Tetradecanoyl-DL-homoserine lactone

CAS: 98206-80-5

N-Tetradecanoyl-DL-homoserine lactone

Formula: C₁₈H₃₃NO₃

Purezza: ≥95%

Peso molecolare: 311.46

Ref: 54-OR1124279

N-Tetradecanoyl-DL-homoserine lactone

CAS: 98206-80-5

Formula: C₁₈H₃₃NO₃

Purezza: 97%

Peso molecolare: 311.4595

Ref: IN-DA01FL2S

N-Tetradecanoyl-DL-homoserine lactone

CAS: 98206-80-5

Ref: 7W-GW2349

Tetradecanamide, N-(tetrahydro-2-oxo-3-furanyl)-

CAS: 98206-80-5

Purezza: ≥97%(HPLC)

Peso molecolare: 311.4660034

Ref: 10-F866889

N-Tetradecanoyl-DL-Homoserine Lactone

Prodotto controllato

CAS: 98206-80-5

Applications N-Tetradecanoyl-DL-Homoserine Lactone is a homoserine lactone compound used in quorum sensing.
References Dunstall, G., et al.: J. Dairy Res., 72, 276 (2005); Ma, C., et al.: Weishengwuxue Tongbao, 40, 2005 (2013)

Formula: C₁₈H₃₃NO₃

Colore e forma: Neat

Peso molecolare: 311.459

Ref: TR-T292680

N-Tetradecanoyl-DL-homoserine lactone

CAS: 98206-80-5

N-Tetradecanoyl-DL-homoserine lactone is a type of acyl-homoserine lactone (AHL), a category of molecules primarily known for their role in quorum sensing (QS) among Gram-negative bacteria. This compound is typically derived through bacterial synthesis, where it is produced by the enzymatic action of LuxI-type proteins. These proteins catalyze the formation of the lactone ring and esterify specific acyl chains, such as the tetradecanoyl group in this case.

Formula: C₁₈H₃₃NO₃

Purezza: Min. 95%

Peso molecolare: 311.5 g/mol

Ref: 3D-YDA20680