CAS 98406-04-3

Formula: C8H7ClO3

InChI: InChI=1S/C8H7ClO3/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4,10H,1H3

InChI key: AUILWNSXFXPDID-UHFFFAOYSA-N

SMILES: COC(=O)C1=CC(=CC(=C1)Cl)O

Methyl 3-chloro-5-hydroxybenzoate

CAS: 98406-04-3

Methyl 3-chloro-5-hydroxybenzoate

Formula: C₈H₇ClO₃

Purezza: 98%

Peso molecolare: 186.59237

Ref: 54-OR955921

Methyl 3-chloro-5-hydroxybenzoate

CAS: 98406-04-3

Formula: C₈H₇ClO₃

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 186.5924

Ref: IN-DA0068E2

Methyl 3-chloro-5-hydroxybenzoate

CAS: 98406-04-3

Methyl 3-chloro-5-hydroxybenzoate

Formula: C₈H₇ClO₃

Purezza: 98%

Peso molecolare: 186.59

Ref: IN-DG231851

3-Chloro-5-hydroxybenzoic acid methyl ester

CAS: 98406-04-3

3-Chloro-5-hydroxybenzoic acid methyl ester is a fine chemical that can be used as a versatile building block and reaction component in the synthesis of complex compounds. It is soluble in organic solvents such as dichloromethane, chloroform, and acetone. 3-Chloro-5-hydroxybenzoic acid methyl ester has CAS No. 98406-04-3 and a molecular weight of 149. 2.

Formula: C₈H₇ClO₃

Purezza: Min. 98 Area-%

Colore e forma: White Off-White Powder

Peso molecolare: 186.59 g/mol

Ref: 3D-FC178108

Methyl 3-chloro-5-hydroxybenzoate

CAS: 98406-04-3

Formula: C₈H₇ClO₃

Purezza: 98%

Peso molecolare: 186.59

Ref: 10-F457638