CAS 98751-78-1

Formula: C10H12O4

InChI: InChI=1S/C10H12O4/c1-5-6-3-8(11)10(2,13)4-7(6)14-9(5)12/h6-7,13H,1,3-4H2,2H3/t6-,7-,10+/m1/s1

InChI key: GFSTVWDPRTWASK-XSSZXYGBSA-N

SMILES: C[C@@]1(C[C@@H]2[C@H](CC1=O)C(=C)C(=O)O2)O

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B

Formula: C₁₀H₁₂O₄

Purezza: ≥95%

Peso molecolare: 196.2

Ref: 54-BUP23125

Paeonilactone B

CAS: 98751-78-1

Formula: C₁₀H₁₂O₄

Purezza: 98%

Colore e forma: Solid

Peso molecolare: 196.1999

Ref: IN-DA00IK5X

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B ((+)-Paeonilactone B) from Paeonia lactiflora has neuroprotective activity, inhibits oxidative stress, and inhibits H2O2-induced neurotoxicity.

Formula: C₁₀H₁₂O₄

Purezza: 96%

Colore e forma: White Solid

Peso molecolare: 196.2

Ref: TM-TN2036

Paeonilactone B

CAS: 98751-78-1

Formula: C₁₀H₁₂O₄

Purezza: 95%~99%

Colore e forma: Powder

Peso molecolare: 196.202

Ref: BP-SBP02789

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B is a bioactive compound, which is a secondary metabolite derived from the roots of Paeonia species, commonly used in traditional medicine. This compound is extracted and identified through advanced chromatographic and spectrometric techniques, given its natural occurrence in the complex matrix of plant materials.

Formula: C₁₀H₁₂O₄

Purezza: Min. 95%

Peso molecolare: 196.2 g/mol

Ref: 3D-YDA75178