CAS 98890-48-3

Formula: C17H17ClN2

InChI: InChI=1S/C17H16N2.ClH/c1-2-12-7-8-16-17-14(9-10-19(16)11-12)13-5-3-4-6-15(13)18-17;/h3-8,11H,2,9-10H2,1H3;1H

InChI key: IYKGVISQUYYIKI-UHFFFAOYSA-N

SMILES: CCC1=C[N+]2=C(C=C1)C3=C(CC2)C4=CC=CC=C4N3.[Cl-]

Dihydroflavopereirine chloride

CAS: 98890-48-3

Dihydroflavopereirine chloride is a commonly used biochemical reagent that can serve as a biomaterial or organic compound for life science research.

Formula: C₁₇H₁₇ClN₂

Peso molecolare: 284.78

Ref: TM-TYD-04781

3-Ethyl-7,12-dihydro-6H-indolo(2,3-A)quinolizin-5-ium chloride

CAS: 98890-48-3

3-Ethyl-7,12-dihydro-6H-indolo(2,3-A)quinolizin-5-ium chloride is a synthetic chemical compound with a complex polycyclic structure, often used within the realm of scientific research. Synthesized through organic chemical processes, it stands as a representative of a class of compounds known for their bioactive properties. The mechanism of action involves interaction with biological macromolecules, leading to potential alterations in cellular processes. It can serve as a pharmacological tool, elucidating pathways in biochemical and pharmacological studies.

Formula: C₁₇H₁₇ClN₂

Purezza: Min. 95%

Peso molecolare: 284.8 g/mol

Ref: 3D-YDA89048