1-Ethyl-3-methylimidazolium aminoacetate
CAS: 766537-74-0
Rif. 3D-RFB53774
| 10g | Prezzo su richiesta | ||
| 25g | Prezzo su richiesta |
Informazioni sul prodotto
1-Ethyl-3-methylimidazolium aminoacetate is a colorless liquid that is soluble in water and organic solvents. It has the chemical formula CH3C(NH2)CH2CH2N(CH3)COO. This compound reacts with many substances, including water and other molecules, at a relatively fast rate. The reaction rate of 1-ethyl-3-methylimidazolium aminoacetate can be measured using techniques such as absorption process, simulations, and viscosity measurements. This compound interacts with others by changing their properties such as viscosity or surface properties. The kinetic constant for this compound can be determined using techniques such as activated enhancement or surface properties.
Proprietà chimiche
Richiesta tecnica su: 3D-RFB53774 1-Ethyl-3-methylimidazolium aminoacetate
Se si desidera richiedere un preventivo o effettuare un ordine, si prega invece di aggiungere i prodotti desiderati al carrello e poi richiedere un preventivo o un ordine dal carrello. È più veloce, più economico, e potrà beneficiare degli sconti disponibili e di altri vantaggi.
