CAS 123940-54-5
:Hipocrelin B
Descrição:
Hipocrelin B é um composto natural classificado como uma perilenoquinona, derivado principalmente do fungo Hypocrea lixii. Apresenta uma cor vermelho escuro a púrpura distinta e é conhecido por suas propriedades fotosensibilizantes, tornando-o de interesse na terapia fotodinâmica (PDT) para o tratamento do câncer. O composto possui uma estrutura molecular complexa caracterizada por múltiplos anéis aromáticos fundidos, contribuindo para sua forte absorção de luz no espectro visível. Hipocrelin B é solúvel em solventes orgânicos, mas tem solubilidade limitada em água, o que pode influenciar sua biodisponibilidade e aplicação terapêutica. Além de seu potencial na terapia do câncer, mostrou atividades antimicrobianas e antivirais, expandindo ainda mais sua relevância na química medicinal. O mecanismo de ação do composto envolve a geração de espécies reativas de oxigênio após a ativação por luz, levando a danos celulares em tecidos-alvo. No geral, Hipocrelin B representa um candidato promissor no campo da fotomedicina, com pesquisas em andamento visando otimizar sua eficácia e segurança para uso clínico.
Fórmula:C30H24O9
InChI:InChI=1S/C30H24O9/c1-10-7-12-18-23-19(27(34)29(12)38-5)13(32)8-15(36-3)21(23)22-16(37-4)9-14(33)20-25(22)24(18)26(17(10)11(2)31)30(39-6)28(20)35/h8-9,32-33H,7H2,1-6H3
Chave InChI:InChIKey=APTUSGMALOMQQL-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C4=C5C(=C6C3C(C1=O)=C(O)C=C6OC)C(OC)=CC(O)=C5C(=O)C(OC)=C4CC(C)=C2C(C)=O
Sinónimos:- 1H-Cyclohepta[ghi]perylene-5,12-dione, 3-acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-
- 3-Acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-1H-cyclohepta[ghi]perylene-5,12-dione
- 6-acetyl-8,9-dihydroxy-3,7,11,12-tetramethoxy-5-methyl-1H-cyclohepta[ghi]perylene-1,2(4H)-dione
- Hc-B
- Hypocrelin B
- Hypocrellin B, Hypocrella Bambusae
- Hypocrellin B
Ordenar por
Pureza (%)
0
100
|
0
|
50
|
90
|
95
|
100
6 produtos.
Hypocrellin B
CAS:Hypocrellin B has sonodynamic action to induce mitochondrial damage, survival inhibition, apoptosis and inhibit adhesion and migration of cancer cells. Photodynamic therapy with Hypocrellin B can remarkably induce apoptosis and inhibit adhesion and migration of cancer cells in vitro.Fórmula:C30H24O9Pureza:95%~99%Peso molecular:528.513HYPOCRELLIN B
CAS:HYPOCRELLIN B, from Hypocrella bambusae, breaks DNA, triggers apoptosis in ovarian cells, and stops Staphylococcus growth via ROS.Fórmula:C30H24O9Pureza:98% - 98.87%Cor e Forma:SolidPeso molecular:528.51Hypocrellin B
CAS:<p>Hypocrellin B is a photosensitizer, which is a compound capable of generating reactive oxygen species upon light activation. It is derived from the perylenequinone family of compounds, primarily sourced from fungi such as Shiraia bambusicola. The mode of action of Hypocrellin B involves the generation of singlet oxygen and other reactive oxygen species when exposed to specific wavelengths of light. This oxidative process can induce cellular damage, making it effective in targeting abnormal cells.</p>Fórmula:C30H24O9Pureza:Min. 95%Peso molecular:528.51 g/mol





